C19H19ClN2O4 — CID 120549686
1-[2-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-2-oxoethyl]cyclobutane-1-carboxylic acid (PubChem CID 120549686) has the molecular formula C19H19ClN2O4 and a molecular weight of 374.82 g/mol. Its IUPAC name is 1-[2-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-2-oxoethyl]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[2-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-2-oxoethyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 120549686 |
| Molecular Formula | C19H19ClN2O4 |
| Molecular Weight | 374.82 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 1-[2-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-2-oxoethyl]cyclobutane-1-carboxylic acid |
| SMILES | O=C(CC1(C(=O)O)CCC1)Nc1ccc(OCc2ccccn2)c(Cl)c1 |
| InChI | InChI=1S/C19H19ClN2O4/c20-15-10-13(22-17(23)11-19(18(24)25)7-3-8-19)5-6-16(15)26-12-14-4-1-2-9-21-14/h1-2,4-6,9-10H,3,7-8,11-12H2,(H,22,23)(H,24,25) |
| InChIKey | KKDKRZIWIDUSBX-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.82 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |