C19H24N2O6 — CID 108866734
1-[2-(4-methoxyphenoxy)ethyl]-3-(3,4,5-trimethoxyphenyl)urea (PubChem CID 108866734) has the molecular formula C19H24N2O6 and a molecular weight of 376.41 g/mol. Its IUPAC name is 1-[2-(4-methoxyphenoxy)ethyl]-3-(3,4,5-trimethoxyphenyl)urea.
| Compound Name | 1-[2-(4-methoxyphenoxy)ethyl]-3-(3,4,5-trimethoxyphenyl)urea |
|---|---|
| PubChem CID | 108866734 |
| Molecular Formula | C19H24N2O6 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 1-[2-(4-methoxyphenoxy)ethyl]-3-(3,4,5-trimethoxyphenyl)urea |
| SMILES | COc1ccc(OCCNC(=O)Nc2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C19H24N2O6/c1-23-14-5-7-15(8-6-14)27-10-9-20-19(22)21-13-11-16(24-2)18(26-4)17(12-13)25-3/h5-8,11-12H,9-10H2,1-4H3,(H2,20,21,22) |
| InChIKey | SPHPBBWPLRTJED-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 87.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|