C14H22N2O4 — CID 47103391
1-butyl-3-(3,4,5-trimethoxyphenyl)urea (PubChem CID 47103391) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is 1-butyl-3-(3,4,5-trimethoxyphenyl)urea.
| Compound Name | 1-butyl-3-(3,4,5-trimethoxyphenyl)urea |
|---|---|
| PubChem CID | 47103391 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 1-butyl-3-(3,4,5-trimethoxyphenyl)urea |
| SMILES | CCCCNC(=O)Nc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C14H22N2O4/c1-5-6-7-15-14(17)16-10-8-11(18-2)13(20-4)12(9-10)19-3/h8-9H,5-7H2,1-4H3,(H2,15,16,17) |
| InChIKey | MRTBINBVQUUORZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|