C15H24N2O4 — CID 51290149
1-pentyl-3-(3,4,5-trimethoxyphenyl)urea (PubChem CID 51290149) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is 1-pentyl-3-(3,4,5-trimethoxyphenyl)urea.
| Compound Name | 1-pentyl-3-(3,4,5-trimethoxyphenyl)urea |
|---|---|
| PubChem CID | 51290149 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 1-pentyl-3-(3,4,5-trimethoxyphenyl)urea |
| SMILES | CCCCCNC(=O)Nc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C15H24N2O4/c1-5-6-7-8-16-15(18)17-11-9-12(19-2)14(21-4)13(10-11)20-3/h9-10H,5-8H2,1-4H3,(H2,16,17,18) |
| InChIKey | SOSZUMQTUDDSDJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|