C16H17FN2O3 — CID 23938828
1-[(3,5-dimethoxyphenyl)methyl]-3-(2-fluorophenyl)urea (PubChem CID 23938828) has the molecular formula C16H17FN2O3 and a molecular weight of 304.32 g/mol. Its IUPAC name is 1-[(3,5-dimethoxyphenyl)methyl]-3-(2-fluorophenyl)urea.
| Compound Name | 1-[(3,5-dimethoxyphenyl)methyl]-3-(2-fluorophenyl)urea |
|---|---|
| PubChem CID | 23938828 |
| Molecular Formula | C16H17FN2O3 |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 1-[(3,5-dimethoxyphenyl)methyl]-3-(2-fluorophenyl)urea |
| SMILES | COc1cc(CNC(=O)Nc2ccccc2F)cc(OC)c1 |
| InChI | InChI=1S/C16H17FN2O3/c1-21-12-7-11(8-13(9-12)22-2)10-18-16(20)19-15-6-4-3-5-14(15)17/h3-9H,10H2,1-2H3,(H2,18,19,20) |
| InChIKey | GSZXQGRIPUVSGP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |