C16H14F3NO3 — CID 110672522
N-[(3,5-dimethoxyphenyl)methyl]-2,3,4-trifluorobenzamide (PubChem CID 110672522) has the molecular formula C16H14F3NO3 and a molecular weight of 325.29 g/mol. Its IUPAC name is N-[(3,5-dimethoxyphenyl)methyl]-2,3,4-trifluorobenzamide.
| Compound Name | N-[(3,5-dimethoxyphenyl)methyl]-2,3,4-trifluorobenzamide |
|---|---|
| PubChem CID | 110672522 |
| Molecular Formula | C16H14F3NO3 |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | N-[(3,5-dimethoxyphenyl)methyl]-2,3,4-trifluorobenzamide |
| SMILES | COc1cc(CNC(=O)c2ccc(F)c(F)c2F)cc(OC)c1 |
| InChI | InChI=1S/C16H14F3NO3/c1-22-10-5-9(6-11(7-10)23-2)8-20-16(21)12-3-4-13(17)15(19)14(12)18/h3-7H,8H2,1-2H3,(H,20,21) |
| InChIKey | VBUWXKJSDSICRM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|