C11H13F3N2O — CID 3263261
1-(2,5-dimethylphenyl)-3-(2,2,2-trifluoroethyl)urea (PubChem CID 3263261) has the molecular formula C11H13F3N2O and a molecular weight of 246.23 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(2,5-dimethylphenyl)-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 3263261 |
| Molecular Formula | C11H13F3N2O |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-3-(2,2,2-trifluoroethyl)urea |
| SMILES | Cc1ccc(C)c(NC(=O)NCC(F)(F)F)c1 |
| InChI | InChI=1S/C11H13F3N2O/c1-7-3-4-8(2)9(5-7)16-10(17)15-6-11(12,13)14/h3-5H,6H2,1-2H3,(H2,15,16,17) |
| InChIKey | RSLLBKHSBBVJDH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |