C12H15F3N2O — CID 78914656
N-(2,5-dimethylphenyl)-2-(2,2,2-trifluoroethylamino)acetamide (PubChem CID 78914656) has the molecular formula C12H15F3N2O and a molecular weight of 260.26 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-2-(2,2,2-trifluoroethylamino)acetamide.
| Compound Name | N-(2,5-dimethylphenyl)-2-(2,2,2-trifluoroethylamino)acetamide |
|---|---|
| PubChem CID | 78914656 |
| Molecular Formula | C12H15F3N2O |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | N-(2,5-dimethylphenyl)-2-(2,2,2-trifluoroethylamino)acetamide |
| SMILES | Cc1ccc(C)c(NC(=O)CNCC(F)(F)F)c1 |
| InChI | InChI=1S/C12H15F3N2O/c1-8-3-4-9(2)10(5-8)17-11(18)6-16-7-12(13,14)15/h3-5,16H,6-7H2,1-2H3,(H,17,18) |
| InChIKey | JGSOVGAMZHBHPW-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |