C11H16N2O — CID 2396341
N-(2,5-dimethylphenyl)-2-(methylamino)acetamide (PubChem CID 2396341) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-2-(methylamino)acetamide.
| Compound Name | N-(2,5-dimethylphenyl)-2-(methylamino)acetamide |
|---|---|
| PubChem CID | 2396341 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | N-(2,5-dimethylphenyl)-2-(methylamino)acetamide |
| SMILES | CNCC(=O)Nc1cc(C)ccc1C |
| InChI | InChI=1S/C11H16N2O/c1-8-4-5-9(2)10(6-8)13-11(14)7-12-3/h4-6,12H,7H2,1-3H3,(H,13,14) |
| InChIKey | CECYGDCUGARSKV-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |