C10H10F3N3O3 — CID 116657554
1-(4-methyl-2-nitrophenyl)-3-(2,2,2-trifluoroethyl)urea (PubChem CID 116657554) has the molecular formula C10H10F3N3O3 and a molecular weight of 277.20 g/mol. Its IUPAC name is 1-(4-methyl-2-nitrophenyl)-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(4-methyl-2-nitrophenyl)-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 116657554 |
| Molecular Formula | C10H10F3N3O3 |
| Molecular Weight | 277.20 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 1-(4-methyl-2-nitrophenyl)-3-(2,2,2-trifluoroethyl)urea |
| SMILES | Cc1ccc(NC(=O)NCC(F)(F)F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H10F3N3O3/c1-6-2-3-7(8(4-6)16(18)19)15-9(17)14-5-10(11,12)13/h2-4H,5H2,1H3,(H2,14,15,17) |
| InChIKey | WOHMWSPNWUTWNN-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.20 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|