C9H7F4N3O3 — CID 116655173
1-(2-fluoro-4-nitrophenyl)-3-(2,2,2-trifluoroethyl)urea (PubChem CID 116655173) has the molecular formula C9H7F4N3O3 and a molecular weight of 281.17 g/mol. Its IUPAC name is 1-(2-fluoro-4-nitrophenyl)-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(2-fluoro-4-nitrophenyl)-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 116655173 |
| Molecular Formula | C9H7F4N3O3 |
| Molecular Weight | 281.17 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 1-(2-fluoro-4-nitrophenyl)-3-(2,2,2-trifluoroethyl)urea |
| SMILES | O=C(NCC(F)(F)F)Nc1ccc([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C9H7F4N3O3/c10-6-3-5(16(18)19)1-2-7(6)15-8(17)14-4-9(11,12)13/h1-3H,4H2,(H2,14,15,17) |
| InChIKey | KNABYPPORLRUNB-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.17 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|