C13H11FN4O5S — CID 141330135
1-(2-fluoro-4-nitrophenyl)-3-(4-sulfamoylphenyl)urea (PubChem CID 141330135) has the molecular formula C13H11FN4O5S and a molecular weight of 354.32 g/mol. Its IUPAC name is 1-(2-fluoro-4-nitrophenyl)-3-(4-sulfamoylphenyl)urea.
| Compound Name | 1-(2-fluoro-4-nitrophenyl)-3-(4-sulfamoylphenyl)urea |
|---|---|
| PubChem CID | 141330135 |
| Molecular Formula | C13H11FN4O5S |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 1-(2-fluoro-4-nitrophenyl)-3-(4-sulfamoylphenyl)urea |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)Nc2ccc([N+](=O)[O-])cc2F)cc1 |
| InChI | InChI=1S/C13H11FN4O5S/c14-11-7-9(18(20)21)3-6-12(11)17-13(19)16-8-1-4-10(5-2-8)24(15,22)23/h1-7H,(H2,15,22,23)(H2,16,17,19) |
| InChIKey | DNMIAYZOCBFESA-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 144.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|