C19H12ClF2N3O5S — CID 4591955
1-(2-chloro-4,5-difluorophenyl)-3-[4-(4-nitrophenyl)sulfonylphenyl]urea (PubChem CID 4591955) has the molecular formula C19H12ClF2N3O5S and a molecular weight of 467.84 g/mol. Its IUPAC name is 1-(2-chloro-4,5-difluorophenyl)-3-[4-(4-nitrophenyl)sulfonylphenyl]urea.
| Compound Name | 1-(2-chloro-4,5-difluorophenyl)-3-[4-(4-nitrophenyl)sulfonylphenyl]urea |
|---|---|
| PubChem CID | 4591955 |
| Molecular Formula | C19H12ClF2N3O5S |
| Molecular Weight | 467.84 g/mol |
| Exact Mass | 467.02 |
| IUPAC Name | 1-(2-chloro-4,5-difluorophenyl)-3-[4-(4-nitrophenyl)sulfonylphenyl]urea |
| SMILES | O=C(Nc1ccc(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)cc1)Nc1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C19H12ClF2N3O5S/c20-15-9-16(21)17(22)10-18(15)24-19(26)23-11-1-5-13(6-2-11)31(29,30)14-7-3-12(4-8-14)25(27)28/h1-10H,(H2,23,24,26) |
| InChIKey | FFHAQAILEFBOAA-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.84 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|