C25H20N4O7S2 — CID 156902705
1-[4-[4-(benzenesulfonamido)phenyl]sulfonylphenyl]-3-(4-nitrophenyl)urea (PubChem CID 156902705) has the molecular formula C25H20N4O7S2 and a molecular weight of 552.59 g/mol. Its IUPAC name is 1-[4-[4-(benzenesulfonamido)phenyl]sulfonylphenyl]-3-(4-nitrophenyl)urea.
| Compound Name | 1-[4-[4-(benzenesulfonamido)phenyl]sulfonylphenyl]-3-(4-nitrophenyl)urea |
|---|---|
| PubChem CID | 156902705 |
| Molecular Formula | C25H20N4O7S2 |
| Molecular Weight | 552.59 g/mol |
| Exact Mass | 552.08 |
| IUPAC Name | 1-[4-[4-(benzenesulfonamido)phenyl]sulfonylphenyl]-3-(4-nitrophenyl)urea |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)Nc1ccc(S(=O)(=O)c2ccc(NS(=O)(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C25H20N4O7S2/c30-25(26-18-6-12-21(13-7-18)29(31)32)27-19-8-14-22(15-9-19)37(33,34)23-16-10-20(11-17-23)28-38(35,36)24-4-2-1-3-5-24/h1-17,28H,(H2,26,27,30) |
| InChIKey | PCZZYHQCMMIGRT-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 164.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.59 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|