C20H18N4O6S — CID 171358011
1-(4-methoxyphenyl)-3-[2-[(4-nitrophenyl)sulfonylamino]phenyl]urea (PubChem CID 171358011) has the molecular formula C20H18N4O6S and a molecular weight of 442.45 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-[2-[(4-nitrophenyl)sulfonylamino]phenyl]urea.
| Compound Name | 1-(4-methoxyphenyl)-3-[2-[(4-nitrophenyl)sulfonylamino]phenyl]urea |
|---|---|
| PubChem CID | 171358011 |
| Molecular Formula | C20H18N4O6S |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-[2-[(4-nitrophenyl)sulfonylamino]phenyl]urea |
| SMILES | COc1ccc(NC(=O)Nc2ccccc2NS(=O)(=O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C20H18N4O6S/c1-30-16-10-6-14(7-11-16)21-20(25)22-18-4-2-3-5-19(18)23-31(28,29)17-12-8-15(9-13-17)24(26)27/h2-13,23H,1H3,(H2,21,22,25) |
| InChIKey | CSQZGKKLELVEIQ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 139.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|