C19H14Cl2N4O5S — CID 171352609
1-(3,4-dichlorophenyl)-3-[2-[(4-nitrophenyl)sulfonylamino]phenyl]urea (PubChem CID 171352609) has the molecular formula C19H14Cl2N4O5S and a molecular weight of 481.32 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[2-[(4-nitrophenyl)sulfonylamino]phenyl]urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[2-[(4-nitrophenyl)sulfonylamino]phenyl]urea |
|---|---|
| PubChem CID | 171352609 |
| Molecular Formula | C19H14Cl2N4O5S |
| Molecular Weight | 481.32 g/mol |
| Exact Mass | 480.01 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[2-[(4-nitrophenyl)sulfonylamino]phenyl]urea |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)Nc1ccccc1NS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H14Cl2N4O5S/c20-15-10-5-12(11-16(15)21)22-19(26)23-17-3-1-2-4-18(17)24-31(29,30)14-8-6-13(7-9-14)25(27)28/h1-11,24H,(H2,22,23,26) |
| InChIKey | RHWUNFHGSMKETH-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.32 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|