C14H11Cl2N3O4 — CID 2963634
1-(3,4-dichlorophenyl)-3-(2-methoxy-4-nitrophenyl)urea (PubChem CID 2963634) has the molecular formula C14H11Cl2N3O4 and a molecular weight of 356.17 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-(2-methoxy-4-nitrophenyl)urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-(2-methoxy-4-nitrophenyl)urea |
|---|---|
| PubChem CID | 2963634 |
| Molecular Formula | C14H11Cl2N3O4 |
| Molecular Weight | 356.17 g/mol |
| Exact Mass | 355.01 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-(2-methoxy-4-nitrophenyl)urea |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H11Cl2N3O4/c1-23-13-7-9(19(21)22)3-5-12(13)18-14(20)17-8-2-4-10(15)11(16)6-8/h2-7H,1H3,(H2,17,18,20) |
| InChIKey | WYQJKNXBNKOSPM-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.17 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|