C11H10N4O5 — CID 17282033
1-(2-methoxy-4-nitrophenyl)-3-(1,2-oxazol-3-yl)urea (PubChem CID 17282033) has the molecular formula C11H10N4O5 and a molecular weight of 278.22 g/mol. Its IUPAC name is 1-(2-methoxy-4-nitrophenyl)-3-(1,2-oxazol-3-yl)urea.
| Compound Name | 1-(2-methoxy-4-nitrophenyl)-3-(1,2-oxazol-3-yl)urea |
|---|---|
| PubChem CID | 17282033 |
| Molecular Formula | C11H10N4O5 |
| Molecular Weight | 278.22 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 1-(2-methoxy-4-nitrophenyl)-3-(1,2-oxazol-3-yl)urea |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)Nc1ccon1 |
| InChI | InChI=1S/C11H10N4O5/c1-19-9-6-7(15(17)18)2-3-8(9)12-11(16)13-10-4-5-20-14-10/h2-6H,1H3,(H2,12,13,14,16) |
| InChIKey | QNKBPXDIUZQKOM-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 119.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.22 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|