C16H14Cl2N2O5 — CID 8580012
(2R)-2-(3,4-dichlorophenoxy)-N-(2-methoxy-4-nitrophenyl)propanamide (PubChem CID 8580012) has the molecular formula C16H14Cl2N2O5 and a molecular weight of 385.20 g/mol. Its IUPAC name is (2R)-2-(3,4-dichlorophenoxy)-N-(2-methoxy-4-nitrophenyl)propanamide.
| Compound Name | (2R)-2-(3,4-dichlorophenoxy)-N-(2-methoxy-4-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 8580012 |
| Molecular Formula | C16H14Cl2N2O5 |
| Molecular Weight | 385.20 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | (2R)-2-(3,4-dichlorophenoxy)-N-(2-methoxy-4-nitrophenyl)propanamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)[C@@H](C)Oc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H14Cl2N2O5/c1-9(25-11-4-5-12(17)13(18)8-11)16(21)19-14-6-3-10(20(22)23)7-15(14)24-2/h3-9H,1-2H3,(H,19,21)/t9-/m1/s1 |
| InChIKey | MTODUHZPFYGZER-SECBINFHSA-N |
| XLogP | 4.32 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.20 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|