C16H13Cl3N2O5 — CID 2564232
(2R)-N-(2-methoxy-5-nitrophenyl)-2-(2,4,5-trichlorophenoxy)propanamide (PubChem CID 2564232) has the molecular formula C16H13Cl3N2O5 and a molecular weight of 419.65 g/mol. Its IUPAC name is (2R)-N-(2-methoxy-5-nitrophenyl)-2-(2,4,5-trichlorophenoxy)propanamide.
| Compound Name | (2R)-N-(2-methoxy-5-nitrophenyl)-2-(2,4,5-trichlorophenoxy)propanamide |
|---|---|
| PubChem CID | 2564232 |
| Molecular Formula | C16H13Cl3N2O5 |
| Molecular Weight | 419.65 g/mol |
| Exact Mass | 417.99 |
| IUPAC Name | (2R)-N-(2-methoxy-5-nitrophenyl)-2-(2,4,5-trichlorophenoxy)propanamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)[C@@H](C)Oc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H13Cl3N2O5/c1-8(26-15-7-11(18)10(17)6-12(15)19)16(22)20-13-5-9(21(23)24)3-4-14(13)25-2/h3-8H,1-2H3,(H,20,22)/t8-/m1/s1 |
| InChIKey | YDWUJBCULOCUKD-MRVPVSSYSA-N |
| XLogP | 4.97 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.65 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|