C19H16ClN3O3S — CID 16615674
1-[2-[(4-chlorophenyl)sulfonylamino]phenyl]-3-phenylurea (PubChem CID 16615674) has the molecular formula C19H16ClN3O3S and a molecular weight of 401.88 g/mol. Its IUPAC name is 1-[2-[(4-chlorophenyl)sulfonylamino]phenyl]-3-phenylurea.
| Compound Name | 1-[2-[(4-chlorophenyl)sulfonylamino]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 16615674 |
| Molecular Formula | C19H16ClN3O3S |
| Molecular Weight | 401.88 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | 1-[2-[(4-chlorophenyl)sulfonylamino]phenyl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)Nc1ccccc1NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H16ClN3O3S/c20-14-10-12-16(13-11-14)27(25,26)23-18-9-5-4-8-17(18)22-19(24)21-15-6-2-1-3-7-15/h1-13,23H,(H2,21,22,24) |
| InChIKey | IXALHVLHGNABSL-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.88 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |