C20H17Cl2N3O3S — CID 2983994
1-[4-[(5-chloro-2-methylphenyl)sulfamoyl]phenyl]-3-(4-chlorophenyl)urea (PubChem CID 2983994) has the molecular formula C20H17Cl2N3O3S and a molecular weight of 450.35 g/mol. Its IUPAC name is 1-[4-[(5-chloro-2-methylphenyl)sulfamoyl]phenyl]-3-(4-chlorophenyl)urea.
| Compound Name | 1-[4-[(5-chloro-2-methylphenyl)sulfamoyl]phenyl]-3-(4-chlorophenyl)urea |
|---|---|
| PubChem CID | 2983994 |
| Molecular Formula | C20H17Cl2N3O3S |
| Molecular Weight | 450.35 g/mol |
| Exact Mass | 449.04 |
| IUPAC Name | 1-[4-[(5-chloro-2-methylphenyl)sulfamoyl]phenyl]-3-(4-chlorophenyl)urea |
| SMILES | Cc1ccc(Cl)cc1NS(=O)(=O)c1ccc(NC(=O)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C20H17Cl2N3O3S/c1-13-2-3-15(22)12-19(13)25-29(27,28)18-10-8-17(9-11-18)24-20(26)23-16-6-4-14(21)5-7-16/h2-12,25H,1H3,(H2,23,24,26) |
| InChIKey | ILMZRVOPOIXUOL-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.35 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |