C21H20ClN3O3S — CID 2224609
1-(3-chlorophenyl)-3-[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]urea (PubChem CID 2224609) has the molecular formula C21H20ClN3O3S and a molecular weight of 429.93 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]urea |
|---|---|
| PubChem CID | 2224609 |
| Molecular Formula | C21H20ClN3O3S |
| Molecular Weight | 429.93 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]urea |
| SMILES | Cc1cccc(C)c1NS(=O)(=O)c1ccc(NC(=O)Nc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C21H20ClN3O3S/c1-14-5-3-6-15(2)20(14)25-29(27,28)19-11-9-17(10-12-19)23-21(26)24-18-8-4-7-16(22)13-18/h3-13,25H,1-2H3,(H2,23,24,26) |
| InChIKey | KTDSLHFIAWIDKT-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.93 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |