C18H14Cl2N2O3S2 — CID 70122226
N-(3-chlorophenyl)-3-[(4-chlorophenyl)sulfonylamino]-4-methylthiophene-2-carboxamide (PubChem CID 70122226) has the molecular formula C18H14Cl2N2O3S2 and a molecular weight of 441.36 g/mol. Its IUPAC name is N-(3-chlorophenyl)-3-[(4-chlorophenyl)sulfonylamino]-4-methylthiophene-2-carboxamide.
| Compound Name | N-(3-chlorophenyl)-3-[(4-chlorophenyl)sulfonylamino]-4-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 70122226 |
| Molecular Formula | C18H14Cl2N2O3S2 |
| Molecular Weight | 441.36 g/mol |
| Exact Mass | 439.98 |
| IUPAC Name | N-(3-chlorophenyl)-3-[(4-chlorophenyl)sulfonylamino]-4-methylthiophene-2-carboxamide |
| SMILES | Cc1csc(C(=O)Nc2cccc(Cl)c2)c1NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H14Cl2N2O3S2/c1-11-10-26-17(18(23)21-14-4-2-3-13(20)9-14)16(11)22-27(24,25)15-7-5-12(19)6-8-15/h2-10,22H,1H3,(H,21,23) |
| InChIKey | DTEAPVIAECHQMT-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.36 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |