C17H12Cl2N2O3S2 — CID 70120101
N-(4-chlorophenyl)-3-[(3-chlorophenyl)sulfonylamino]thiophene-2-carboxamide (PubChem CID 70120101) has the molecular formula C17H12Cl2N2O3S2 and a molecular weight of 427.33 g/mol. Its IUPAC name is N-(4-chlorophenyl)-3-[(3-chlorophenyl)sulfonylamino]thiophene-2-carboxamide.
| Compound Name | N-(4-chlorophenyl)-3-[(3-chlorophenyl)sulfonylamino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 70120101 |
| Molecular Formula | C17H12Cl2N2O3S2 |
| Molecular Weight | 427.33 g/mol |
| Exact Mass | 425.97 |
| IUPAC Name | N-(4-chlorophenyl)-3-[(3-chlorophenyl)sulfonylamino]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)c1sccc1NS(=O)(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H12Cl2N2O3S2/c18-11-4-6-13(7-5-11)20-17(22)16-15(8-9-25-16)21-26(23,24)14-3-1-2-12(19)10-14/h1-10,21H,(H,20,22) |
| InChIKey | QSSUFUJWSALUIC-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.33 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |