C18H16N2O4S2 — CID 10178357
3-(benzenesulfonamido)-N-(4-methoxyphenyl)thiophene-2-carboxamide (PubChem CID 10178357) has the molecular formula C18H16N2O4S2 and a molecular weight of 388.47 g/mol. Its IUPAC name is 3-(benzenesulfonamido)-N-(4-methoxyphenyl)thiophene-2-carboxamide.
| Compound Name | 3-(benzenesulfonamido)-N-(4-methoxyphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 10178357 |
| Molecular Formula | C18H16N2O4S2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 3-(benzenesulfonamido)-N-(4-methoxyphenyl)thiophene-2-carboxamide |
| SMILES | COc1ccc(NC(=O)c2sccc2NS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H16N2O4S2/c1-24-14-9-7-13(8-10-14)19-18(21)17-16(11-12-25-17)20-26(22,23)15-5-3-2-4-6-15/h2-12,20H,1H3,(H,19,21) |
| InChIKey | GHGXXXCTQZXYJJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |