C14H14N2O5S2 — CID 19427368
methyl 2-[[3-(benzenesulfonamido)thiophene-2-carbonyl]amino]acetate (PubChem CID 19427368) has the molecular formula C14H14N2O5S2 and a molecular weight of 354.41 g/mol. Its IUPAC name is methyl 2-[[3-(benzenesulfonamido)thiophene-2-carbonyl]amino]acetate.
| Compound Name | methyl 2-[[3-(benzenesulfonamido)thiophene-2-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 19427368 |
| Molecular Formula | C14H14N2O5S2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | methyl 2-[[3-(benzenesulfonamido)thiophene-2-carbonyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)c1sccc1NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H14N2O5S2/c1-21-12(17)9-15-14(18)13-11(7-8-22-13)16-23(19,20)10-5-3-2-4-6-10/h2-8,16H,9H2,1H3,(H,15,18) |
| InChIKey | DSSUMECHBQMLNO-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |