C20H19NO4S2 — CID 67521124
methyl 3-[[3-(2-ethylphenyl)phenyl]sulfonylamino]thiophene-2-carboxylate (PubChem CID 67521124) has the molecular formula C20H19NO4S2 and a molecular weight of 401.51 g/mol. Its IUPAC name is methyl 3-[[3-(2-ethylphenyl)phenyl]sulfonylamino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[[3-(2-ethylphenyl)phenyl]sulfonylamino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 67521124 |
| Molecular Formula | C20H19NO4S2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | methyl 3-[[3-(2-ethylphenyl)phenyl]sulfonylamino]thiophene-2-carboxylate |
| SMILES | CCc1ccccc1-c1cccc(S(=O)(=O)Nc2ccsc2C(=O)OC)c1 |
| InChI | InChI=1S/C20H19NO4S2/c1-3-14-7-4-5-10-17(14)15-8-6-9-16(13-15)27(23,24)21-18-11-12-26-19(18)20(22)25-2/h4-13,21H,3H2,1-2H3 |
| InChIKey | KKFWIYYVMRUZNR-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |