C13H10ClF2NO5S2 — CID 39828527
methyl 3-[[3-chloro-4-(difluoromethoxy)phenyl]sulfonylamino]thiophene-2-carboxylate (PubChem CID 39828527) has the molecular formula C13H10ClF2NO5S2 and a molecular weight of 397.81 g/mol. Its IUPAC name is methyl 3-[[3-chloro-4-(difluoromethoxy)phenyl]sulfonylamino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[[3-chloro-4-(difluoromethoxy)phenyl]sulfonylamino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 39828527 |
| Molecular Formula | C13H10ClF2NO5S2 |
| Molecular Weight | 397.81 g/mol |
| Exact Mass | 396.97 |
| IUPAC Name | methyl 3-[[3-chloro-4-(difluoromethoxy)phenyl]sulfonylamino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NS(=O)(=O)c1ccc(OC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C13H10ClF2NO5S2/c1-21-12(18)11-9(4-5-23-11)17-24(19,20)7-2-3-10(8(14)6-7)22-13(15)16/h2-6,13,17H,1H3 |
| InChIKey | ZXIWBLOQYGIPPM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.81 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |