C16H15ClF2N2O4S2 — CID 56506575
S-[3-[[3-chloro-4-(difluoromethoxy)phenyl]sulfonylamino]phenyl] N,N-dimethylcarbamothioate (PubChem CID 56506575) has the molecular formula C16H15ClF2N2O4S2 and a molecular weight of 436.89 g/mol. Its IUPAC name is S-[3-[[3-chloro-4-(difluoromethoxy)phenyl]sulfonylamino]phenyl] N,N-dimethylcarbamothioate.
| Compound Name | S-[3-[[3-chloro-4-(difluoromethoxy)phenyl]sulfonylamino]phenyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 56506575 |
| Molecular Formula | C16H15ClF2N2O4S2 |
| Molecular Weight | 436.89 g/mol |
| Exact Mass | 436.01 |
| IUPAC Name | S-[3-[[3-chloro-4-(difluoromethoxy)phenyl]sulfonylamino]phenyl] N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=O)Sc1cccc(NS(=O)(=O)c2ccc(OC(F)F)c(Cl)c2)c1 |
| InChI | InChI=1S/C16H15ClF2N2O4S2/c1-21(2)16(22)26-11-5-3-4-10(8-11)20-27(23,24)12-6-7-14(13(17)9-12)25-15(18)19/h3-9,15,20H,1-2H3 |
| InChIKey | QMAZYMSPNRCTCR-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.89 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|