C16H15ClF2N2O5S — CID 39831666
N-[3-[[3-chloro-4-(difluoromethoxy)phenyl]sulfonylamino]phenyl]-2-methoxyacetamide (PubChem CID 39831666) has the molecular formula C16H15ClF2N2O5S and a molecular weight of 420.82 g/mol. Its IUPAC name is N-[3-[[3-chloro-4-(difluoromethoxy)phenyl]sulfonylamino]phenyl]-2-methoxyacetamide.
| Compound Name | N-[3-[[3-chloro-4-(difluoromethoxy)phenyl]sulfonylamino]phenyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 39831666 |
| Molecular Formula | C16H15ClF2N2O5S |
| Molecular Weight | 420.82 g/mol |
| Exact Mass | 420.04 |
| IUPAC Name | N-[3-[[3-chloro-4-(difluoromethoxy)phenyl]sulfonylamino]phenyl]-2-methoxyacetamide |
| SMILES | COCC(=O)Nc1cccc(NS(=O)(=O)c2ccc(OC(F)F)c(Cl)c2)c1 |
| InChI | InChI=1S/C16H15ClF2N2O5S/c1-25-9-15(22)20-10-3-2-4-11(7-10)21-27(23,24)12-5-6-14(13(17)8-12)26-16(18)19/h2-8,16,21H,9H2,1H3,(H,20,22) |
| InChIKey | SQNIQARIPMCCTI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.82 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |