C17H19ClN2O4S — CID 1265933
2-[2-chloro-4-(propan-2-ylsulfamoyl)phenoxy]-N-phenylacetamide (PubChem CID 1265933) has the molecular formula C17H19ClN2O4S and a molecular weight of 382.87 g/mol. Its IUPAC name is 2-[2-chloro-4-(propan-2-ylsulfamoyl)phenoxy]-N-phenylacetamide.
| Compound Name | 2-[2-chloro-4-(propan-2-ylsulfamoyl)phenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 1265933 |
| Molecular Formula | C17H19ClN2O4S |
| Molecular Weight | 382.87 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 2-[2-chloro-4-(propan-2-ylsulfamoyl)phenoxy]-N-phenylacetamide |
| SMILES | CC(C)NS(=O)(=O)c1ccc(OCC(=O)Nc2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C17H19ClN2O4S/c1-12(2)20-25(22,23)14-8-9-16(15(18)10-14)24-11-17(21)19-13-6-4-3-5-7-13/h3-10,12,20H,11H2,1-2H3,(H,19,21) |
| InChIKey | UCMYYSJYMLCIGR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.87 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |