C22H20ClFN2O4S — CID 3618567
2-[2-chloro-4-(1-phenylethylsulfamoyl)phenoxy]-N-(3-fluorophenyl)acetamide (PubChem CID 3618567) has the molecular formula C22H20ClFN2O4S and a molecular weight of 462.93 g/mol. Its IUPAC name is 2-[2-chloro-4-(1-phenylethylsulfamoyl)phenoxy]-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-[2-chloro-4-(1-phenylethylsulfamoyl)phenoxy]-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 3618567 |
| Molecular Formula | C22H20ClFN2O4S |
| Molecular Weight | 462.93 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | 2-[2-chloro-4-(1-phenylethylsulfamoyl)phenoxy]-N-(3-fluorophenyl)acetamide |
| SMILES | CC(NS(=O)(=O)c1ccc(OCC(=O)Nc2cccc(F)c2)c(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C22H20ClFN2O4S/c1-15(16-6-3-2-4-7-16)26-31(28,29)19-10-11-21(20(23)13-19)30-14-22(27)25-18-9-5-8-17(24)12-18/h2-13,15,26H,14H2,1H3,(H,25,27) |
| InChIKey | KMGFFOAKGRAQLZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.93 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |