C23H22ClN3O5S — CID 40975726
4-[[2-[2-chloro-4-[[(1R)-1-phenylethyl]sulfamoyl]phenoxy]acetyl]amino]benzamide (PubChem CID 40975726) has the molecular formula C23H22ClN3O5S and a molecular weight of 487.97 g/mol. Its IUPAC name is 4-[[2-[2-chloro-4-[[(1R)-1-phenylethyl]sulfamoyl]phenoxy]acetyl]amino]benzamide.
| Compound Name | 4-[[2-[2-chloro-4-[[(1R)-1-phenylethyl]sulfamoyl]phenoxy]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 40975726 |
| Molecular Formula | C23H22ClN3O5S |
| Molecular Weight | 487.97 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | 4-[[2-[2-chloro-4-[[(1R)-1-phenylethyl]sulfamoyl]phenoxy]acetyl]amino]benzamide |
| SMILES | C[C@@H](NS(=O)(=O)c1ccc(OCC(=O)Nc2ccc(C(N)=O)cc2)c(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C23H22ClN3O5S/c1-15(16-5-3-2-4-6-16)27-33(30,31)19-11-12-21(20(24)13-19)32-14-22(28)26-18-9-7-17(8-10-18)23(25)29/h2-13,15,27H,14H2,1H3,(H2,25,29)(H,26,28)/t15-/m1/s1 |
| InChIKey | BMMGHWJSTUAGRD-OAHLLOKOSA-N |
| XLogP | 3.50 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.97 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |