C13H19ClN2O5S — CID 3304224
2-[2-chloro-4-(propan-2-ylsulfamoyl)phenoxy]-N-(2-hydroxyethyl)acetamide (PubChem CID 3304224) has the molecular formula C13H19ClN2O5S and a molecular weight of 350.82 g/mol. Its IUPAC name is 2-[2-chloro-4-(propan-2-ylsulfamoyl)phenoxy]-N-(2-hydroxyethyl)acetamide.
| Compound Name | 2-[2-chloro-4-(propan-2-ylsulfamoyl)phenoxy]-N-(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 3304224 |
| Molecular Formula | C13H19ClN2O5S |
| Molecular Weight | 350.82 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | 2-[2-chloro-4-(propan-2-ylsulfamoyl)phenoxy]-N-(2-hydroxyethyl)acetamide |
| SMILES | CC(C)NS(=O)(=O)c1ccc(OCC(=O)NCCO)c(Cl)c1 |
| InChI | InChI=1S/C13H19ClN2O5S/c1-9(2)16-22(19,20)10-3-4-12(11(14)7-10)21-8-13(18)15-5-6-17/h3-4,7,9,16-17H,5-6,8H2,1-2H3,(H,15,18) |
| InChIKey | WZZHWVWFONFGMY-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.82 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |