C10H10ClF2NO6S — CID 104936024
(2S)-3-[[3-chloro-4-(difluoromethoxy)phenyl]sulfonylamino]-2-hydroxypropanoic acid (PubChem CID 104936024) has the molecular formula C10H10ClF2NO6S and a molecular weight of 345.71 g/mol. Its IUPAC name is (2S)-3-[[3-chloro-4-(difluoromethoxy)phenyl]sulfonylamino]-2-hydroxypropanoic acid.
| Compound Name | (2S)-3-[[3-chloro-4-(difluoromethoxy)phenyl]sulfonylamino]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 104936024 |
| Molecular Formula | C10H10ClF2NO6S |
| Molecular Weight | 345.71 g/mol |
| Exact Mass | 344.99 |
| IUPAC Name | (2S)-3-[[3-chloro-4-(difluoromethoxy)phenyl]sulfonylamino]-2-hydroxypropanoic acid |
| SMILES | O=C(O)[C@@H](O)CNS(=O)(=O)c1ccc(OC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C10H10ClF2NO6S/c11-6-3-5(1-2-8(6)20-10(12)13)21(18,19)14-4-7(15)9(16)17/h1-3,7,10,14-15H,4H2,(H,16,17)/t7-/m0/s1 |
| InChIKey | CJOSWEMLJQWZRY-ZETCQYMHSA-N |
| XLogP | 0.67 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.71 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |