C12H17ClF2N2O3S — CID 62662809
3-chloro-4-(difluoromethoxy)-N-[2-(propylamino)ethyl]benzenesulfonamide (PubChem CID 62662809) has the molecular formula C12H17ClF2N2O3S and a molecular weight of 342.80 g/mol. Its IUPAC name is 3-chloro-4-(difluoromethoxy)-N-[2-(propylamino)ethyl]benzenesulfonamide.
| Compound Name | 3-chloro-4-(difluoromethoxy)-N-[2-(propylamino)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 62662809 |
| Molecular Formula | C12H17ClF2N2O3S |
| Molecular Weight | 342.80 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 3-chloro-4-(difluoromethoxy)-N-[2-(propylamino)ethyl]benzenesulfonamide |
| SMILES | CCCNCCNS(=O)(=O)c1ccc(OC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C12H17ClF2N2O3S/c1-2-5-16-6-7-17-21(18,19)9-3-4-11(10(13)8-9)20-12(14)15/h3-4,8,12,16-17H,2,5-7H2,1H3 |
| InChIKey | IDMOZIADAKDDJU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.80 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|