C15H27ClN2O2S — CID 120716186
3,4-diethyl-N-[2-(propylamino)ethyl]benzenesulfonamide;hydrochloride (PubChem CID 120716186) has the molecular formula C15H27ClN2O2S and a molecular weight of 334.91 g/mol. Its IUPAC name is 3,4-diethyl-N-[2-(propylamino)ethyl]benzenesulfonamide;hydrochloride.
| Compound Name | 3,4-diethyl-N-[2-(propylamino)ethyl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120716186 |
| Molecular Formula | C15H27ClN2O2S |
| Molecular Weight | 334.91 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 3,4-diethyl-N-[2-(propylamino)ethyl]benzenesulfonamide;hydrochloride |
| SMILES | CCCNCCNS(=O)(=O)c1ccc(CC)c(CC)c1.Cl |
| InChI | InChI=1S/C15H26N2O2S.ClH/c1-4-9-16-10-11-17-20(18,19)15-8-7-13(5-2)14(6-3)12-15;/h7-8,12,16-17H,4-6,9-11H2,1-3H3;1H |
| InChIKey | REXIAAIXIKLYCV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.91 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|