C13H23ClN2O4S2 — CID 120715832
4-(methylsulfonylmethyl)-N-[2-(propylamino)ethyl]benzenesulfonamide;hydrochloride (PubChem CID 120715832) has the molecular formula C13H23ClN2O4S2 and a molecular weight of 370.92 g/mol. Its IUPAC name is 4-(methylsulfonylmethyl)-N-[2-(propylamino)ethyl]benzenesulfonamide;hydrochloride.
| Compound Name | 4-(methylsulfonylmethyl)-N-[2-(propylamino)ethyl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120715832 |
| Molecular Formula | C13H23ClN2O4S2 |
| Molecular Weight | 370.92 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 4-(methylsulfonylmethyl)-N-[2-(propylamino)ethyl]benzenesulfonamide;hydrochloride |
| SMILES | CCCNCCNS(=O)(=O)c1ccc(CS(C)(=O)=O)cc1.Cl |
| InChI | InChI=1S/C13H22N2O4S2.ClH/c1-3-8-14-9-10-15-21(18,19)13-6-4-12(5-7-13)11-20(2,16)17;/h4-7,14-15H,3,8-11H2,1-2H3;1H |
| InChIKey | AQXOCIBBIYACHZ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.92 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|