C10H15NO4S2 — CID 160796965
N-ethyl-4-(methylsulfonylmethyl)benzenesulfonamide (PubChem CID 160796965) has the molecular formula C10H15NO4S2 and a molecular weight of 277.37 g/mol. Its IUPAC name is N-ethyl-4-(methylsulfonylmethyl)benzenesulfonamide.
| Compound Name | N-ethyl-4-(methylsulfonylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 160796965 |
| Molecular Formula | C10H15NO4S2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | N-ethyl-4-(methylsulfonylmethyl)benzenesulfonamide |
| SMILES | CCNS(=O)(=O)c1ccc(CS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C10H15NO4S2/c1-3-11-17(14,15)10-6-4-9(5-7-10)8-16(2,12)13/h4-7,11H,3,8H2,1-2H3 |
| InChIKey | FAYORVPAFJDNLM-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |