C14H24N2O4S2 — CID 119990095
N-(2-amino-2-ethylbutyl)-4-(methylsulfonylmethyl)benzenesulfonamide (PubChem CID 119990095) has the molecular formula C14H24N2O4S2 and a molecular weight of 348.49 g/mol. Its IUPAC name is N-(2-amino-2-ethylbutyl)-4-(methylsulfonylmethyl)benzenesulfonamide.
| Compound Name | N-(2-amino-2-ethylbutyl)-4-(methylsulfonylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 119990095 |
| Molecular Formula | C14H24N2O4S2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | N-(2-amino-2-ethylbutyl)-4-(methylsulfonylmethyl)benzenesulfonamide |
| SMILES | CCC(N)(CC)CNS(=O)(=O)c1ccc(CS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C14H24N2O4S2/c1-4-14(15,5-2)11-16-22(19,20)13-8-6-12(7-9-13)10-21(3,17)18/h6-9,16H,4-5,10-11,15H2,1-3H3 |
| InChIKey | ZUDMFTXDSUEZDR-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |