C12H18F3N3O2S — CID 120711887
N-(2-amino-2-ethylbutyl)-6-(trifluoromethyl)pyridine-3-sulfonamide (PubChem CID 120711887) has the molecular formula C12H18F3N3O2S and a molecular weight of 325.36 g/mol. Its IUPAC name is N-(2-amino-2-ethylbutyl)-6-(trifluoromethyl)pyridine-3-sulfonamide.
| Compound Name | N-(2-amino-2-ethylbutyl)-6-(trifluoromethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 120711887 |
| Molecular Formula | C12H18F3N3O2S |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | N-(2-amino-2-ethylbutyl)-6-(trifluoromethyl)pyridine-3-sulfonamide |
| SMILES | CCC(N)(CC)CNS(=O)(=O)c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C12H18F3N3O2S/c1-3-11(16,4-2)8-18-21(19,20)9-5-6-10(17-7-9)12(13,14)15/h5-7,18H,3-4,8,16H2,1-2H3 |
| InChIKey | NRBMBGQGZOHWKE-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |