C6H5F3N2O2S — CID 59268886
6-(trifluoromethyl)pyridine-3-sulfonamide (PubChem CID 59268886) has the molecular formula C6H5F3N2O2S and a molecular weight of 226.18 g/mol. Its IUPAC name is 6-(trifluoromethyl)pyridine-3-sulfonamide.
| Compound Name | 6-(trifluoromethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 59268886 |
| Molecular Formula | C6H5F3N2O2S |
| Molecular Weight | 226.18 g/mol |
| Exact Mass | 226.00 |
| IUPAC Name | 6-(trifluoromethyl)pyridine-3-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C6H5F3N2O2S/c7-6(8,9)5-2-1-4(3-11-5)14(10,12)13/h1-3H,(H2,10,12,13) |
| InChIKey | LNGCWLNVGKBMEH-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.18 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |