C14H15F3N2O2S — CID 97349788
(3aR,7aS)-2-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]-1,3,3a,4,7,7a-hexahydroisoindole (PubChem CID 97349788) has the molecular formula C14H15F3N2O2S and a molecular weight of 332.35 g/mol. Its IUPAC name is (3aR,7aS)-2-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]-1,3,3a,4,7,7a-hexahydroisoindole.
| Compound Name | (3aR,7aS)-2-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]-1,3,3a,4,7,7a-hexahydroisoindole |
|---|---|
| PubChem CID | 97349788 |
| Molecular Formula | C14H15F3N2O2S |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | (3aR,7aS)-2-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]-1,3,3a,4,7,7a-hexahydroisoindole |
| SMILES | O=S(=O)(c1ccc(C(F)(F)F)nc1)N1C[C@H]2CC=CC[C@H]2C1 |
| InChI | InChI=1S/C14H15F3N2O2S/c15-14(16,17)13-6-5-12(7-18-13)22(20,21)19-8-10-3-1-2-4-11(10)9-19/h1-2,5-7,10-11H,3-4,8-9H2/t10-,11+ |
| InChIKey | JIKXCBPKUUPOQZ-PHIMTYICSA-N |
| XLogP | 2.69 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|