C11H11F3N2O4S — CID 122068541
1-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]pyrrolidine-3-carboxylic acid (PubChem CID 122068541) has the molecular formula C11H11F3N2O4S and a molecular weight of 324.28 g/mol. Its IUPAC name is 1-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 1-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122068541 |
| Molecular Formula | C11H11F3N2O4S |
| Molecular Weight | 324.28 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 1-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCN(S(=O)(=O)c2ccc(C(F)(F)F)nc2)C1 |
| InChI | InChI=1S/C11H11F3N2O4S/c12-11(13,14)9-2-1-8(5-15-9)21(19,20)16-4-3-7(6-16)10(17)18/h1-2,5,7H,3-4,6H2,(H,17,18) |
| InChIKey | IPAKIJCRXNUTGO-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.28 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |