C12H12F3NO5S — CID 122068419
1-[2-hydroxy-5-(trifluoromethyl)phenyl]sulfonylpyrrolidine-3-carboxylic acid (PubChem CID 122068419) has the molecular formula C12H12F3NO5S and a molecular weight of 339.29 g/mol. Its IUPAC name is 1-[2-hydroxy-5-(trifluoromethyl)phenyl]sulfonylpyrrolidine-3-carboxylic acid.
| Compound Name | 1-[2-hydroxy-5-(trifluoromethyl)phenyl]sulfonylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122068419 |
| Molecular Formula | C12H12F3NO5S |
| Molecular Weight | 339.29 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | 1-[2-hydroxy-5-(trifluoromethyl)phenyl]sulfonylpyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCN(S(=O)(=O)c2cc(C(F)(F)F)ccc2O)C1 |
| InChI | InChI=1S/C12H12F3NO5S/c13-12(14,15)8-1-2-9(17)10(5-8)22(20,21)16-4-3-7(6-16)11(18)19/h1-2,5,7,17H,3-4,6H2,(H,18,19) |
| InChIKey | YLCIAVZPEZJGGL-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.29 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |