C11H12ClNO4S — CID 63030799
1-(2-chlorophenyl)sulfonylpyrrolidine-3-carboxylic acid (PubChem CID 63030799) has the molecular formula C11H12ClNO4S and a molecular weight of 289.74 g/mol. Its IUPAC name is 1-(2-chlorophenyl)sulfonylpyrrolidine-3-carboxylic acid.
| Compound Name | 1-(2-chlorophenyl)sulfonylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 63030799 |
| Molecular Formula | C11H12ClNO4S |
| Molecular Weight | 289.74 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | 1-(2-chlorophenyl)sulfonylpyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCN(S(=O)(=O)c2ccccc2Cl)C1 |
| InChI | InChI=1S/C11H12ClNO4S/c12-9-3-1-2-4-10(9)18(16,17)13-6-5-8(7-13)11(14)15/h1-4,8H,5-7H2,(H,14,15) |
| InChIKey | JJDRUQDYDPUMBS-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.74 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |