C11H11BrClNO4S — CID 114269255
1-(2-bromo-6-chlorophenyl)sulfonylpyrrolidine-3-carboxylic acid (PubChem CID 114269255) has the molecular formula C11H11BrClNO4S and a molecular weight of 368.64 g/mol. Its IUPAC name is 1-(2-bromo-6-chlorophenyl)sulfonylpyrrolidine-3-carboxylic acid.
| Compound Name | 1-(2-bromo-6-chlorophenyl)sulfonylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 114269255 |
| Molecular Formula | C11H11BrClNO4S |
| Molecular Weight | 368.64 g/mol |
| Exact Mass | 366.93 |
| IUPAC Name | 1-(2-bromo-6-chlorophenyl)sulfonylpyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCN(S(=O)(=O)c2c(Cl)cccc2Br)C1 |
| InChI | InChI=1S/C11H11BrClNO4S/c12-8-2-1-3-9(13)10(8)19(17,18)14-5-4-7(6-14)11(15)16/h1-3,7H,4-6H2,(H,15,16) |
| InChIKey | RBHOSDFEBPVLJL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.64 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |