C11H14BrClN2O2S — CID 120998816
1-(2-bromo-6-chlorophenyl)sulfonylpiperidin-3-amine (PubChem CID 120998816) has the molecular formula C11H14BrClN2O2S and a molecular weight of 353.67 g/mol. Its IUPAC name is 1-(2-bromo-6-chlorophenyl)sulfonylpiperidin-3-amine.
| Compound Name | 1-(2-bromo-6-chlorophenyl)sulfonylpiperidin-3-amine |
|---|---|
| PubChem CID | 120998816 |
| Molecular Formula | C11H14BrClN2O2S |
| Molecular Weight | 353.67 g/mol |
| Exact Mass | 351.96 |
| IUPAC Name | 1-(2-bromo-6-chlorophenyl)sulfonylpiperidin-3-amine |
| SMILES | NC1CCCN(S(=O)(=O)c2c(Cl)cccc2Br)C1 |
| InChI | InChI=1S/C11H14BrClN2O2S/c12-9-4-1-5-10(13)11(9)18(16,17)15-6-2-3-8(14)7-15/h1,4-5,8H,2-3,6-7,14H2 |
| InChIKey | ZXVLLTYBJXVSRC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.67 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |