C11H15ClN2O2S — CID 43123365
1-(2-chlorophenyl)sulfonylpiperidin-3-amine (PubChem CID 43123365) has the molecular formula C11H15ClN2O2S and a molecular weight of 274.77 g/mol. Its IUPAC name is 1-(2-chlorophenyl)sulfonylpiperidin-3-amine.
| Compound Name | 1-(2-chlorophenyl)sulfonylpiperidin-3-amine |
|---|---|
| PubChem CID | 43123365 |
| Molecular Formula | C11H15ClN2O2S |
| Molecular Weight | 274.77 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 1-(2-chlorophenyl)sulfonylpiperidin-3-amine |
| SMILES | NC1CCCN(S(=O)(=O)c2ccccc2Cl)C1 |
| InChI | InChI=1S/C11H15ClN2O2S/c12-10-5-1-2-6-11(10)17(15,16)14-7-3-4-9(13)8-14/h1-2,5-6,9H,3-4,7-8,13H2 |
| InChIKey | BJZWQBLHZGUIES-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.77 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |